C22H24ClN3O — CID 90261013
4-[(1S)-3-[[(1R)-1-(3-chlorophenyl)ethyl]amino]cyclopentyl]-N-(cyanomethyl)benzamide (PubChem CID 90261013) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is 4-[(1S)-3-[[(1R)-1-(3-chlorophenyl)ethyl]amino]cyclopentyl]-N-(cyanomethyl)benzamide.
| Compound Name | 4-[(1S)-3-[[(1R)-1-(3-chlorophenyl)ethyl]amino]cyclopentyl]-N-(cyanomethyl)benzamide |
|---|---|
| PubChem CID | 90261013 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[(1S)-3-[[(1R)-1-(3-chlorophenyl)ethyl]amino]cyclopentyl]-N-(cyanomethyl)benzamide |
| SMILES | C[C@@H](NC1CC[C@H](c2ccc(C(=O)NCC#N)cc2)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O/c1-15(18-3-2-4-20(23)13-18)26-21-10-9-19(14-21)16-5-7-17(8-6-16)22(27)25-12-11-24/h2-8,13,15,19,21,26H,9-10,12,14H2,1H3,(H,25,27)/t15-,19+,21?/m1/s1 |
| InChIKey | IADZDEFBPGOKHS-GAKLZJQJSA-N |
| XLogP | 4.58 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|