C22H27ClN4O3S — CID 90750407
4-[3-[1-(3-chlorophenyl)ethylamino]cyclopentyl]-N-[(E)-2-(hydrazinesulfonyl)ethenyl]benzamide (PubChem CID 90750407) has the molecular formula C22H27ClN4O3S and a molecular weight of 463.00 g/mol. Its IUPAC name is 4-[3-[1-(3-chlorophenyl)ethylamino]cyclopentyl]-N-[(E)-2-(hydrazinesulfonyl)ethenyl]benzamide.
| Compound Name | 4-[3-[1-(3-chlorophenyl)ethylamino]cyclopentyl]-N-[(E)-2-(hydrazinesulfonyl)ethenyl]benzamide |
|---|---|
| PubChem CID | 90750407 |
| Molecular Formula | C22H27ClN4O3S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-[3-[1-(3-chlorophenyl)ethylamino]cyclopentyl]-N-[(E)-2-(hydrazinesulfonyl)ethenyl]benzamide |
| SMILES | CC(NC1CCC(c2ccc(C(=O)N/C=C/S(=O)(=O)NN)cc2)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H27ClN4O3S/c1-15(18-3-2-4-20(23)13-18)26-21-10-9-19(14-21)16-5-7-17(8-6-16)22(28)25-11-12-31(29,30)27-24/h2-8,11-13,15,19,21,26-27H,9-10,14,24H2,1H3,(H,25,28)/b12-11+ |
| InChIKey | VNYUREJLSWSZBW-VAWYXSNFSA-N |
| XLogP | 3.32 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|