C20H23ClFNO2S — CID 75298644
N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(4-methylsulfonylphenyl)cyclopentan-1-amine (PubChem CID 75298644) has the molecular formula C20H23ClFNO2S and a molecular weight of 395.93 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(4-methylsulfonylphenyl)cyclopentan-1-amine.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(4-methylsulfonylphenyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 75298644 |
| Molecular Formula | C20H23ClFNO2S |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-3-(4-methylsulfonylphenyl)cyclopentan-1-amine |
| SMILES | CC(NC1CCC(c2ccc(S(C)(=O)=O)cc2)C1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClFNO2S/c1-13(15-6-10-20(22)19(21)12-15)23-17-7-3-16(11-17)14-4-8-18(9-5-14)26(2,24)25/h4-6,8-10,12-13,16-17,23H,3,7,11H2,1-2H3 |
| InChIKey | QGXZPZGPECINHZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |