C18H20ClFN2 — CID 86698384
cis-(1S,3R)-N-[(1R)-1-(3-chlorophenyl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine (PubChem CID 86698384) has the molecular formula C18H20ClFN2 and a molecular weight of 318.82 g/mol. Its IUPAC name is cis-(1S,3R)-N-[(1R)-1-(3-chlorophenyl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine.
| Compound Name | cis-(1S,3R)-N-[(1R)-1-(3-chlorophenyl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 86698384 |
| Molecular Formula | C18H20ClFN2 |
| Molecular Weight | 318.82 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | cis-(1S,3R)-N-[(1R)-1-(3-chlorophenyl)ethyl]-3-(6-fluoro-3-pyridinyl)cyclopentan-1-amine |
| SMILES | C[C@@H](N[C@H]1CC[C@@H](c2ccc(F)nc2)C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20ClFN2/c1-12(13-3-2-4-16(19)9-13)22-17-7-5-14(10-17)15-6-8-18(20)21-11-15/h2-4,6,8-9,11-12,14,17,22H,5,7,10H2,1H3/t12-,14-,17+/m1/s1 |
| InChIKey | DRSLHQNNHKEVFA-MRRJBJDNSA-N |
| XLogP | 4.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|