C30H43FN2O4 — CID 91531453
4-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]cyclopentyl]-N-[7-hydroxy-4-(2-hydroxyethyl)heptyl]benzamide (PubChem CID 91531453) has the molecular formula C30H43FN2O4 and a molecular weight of 514.68 g/mol. Its IUPAC name is 4-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]cyclopentyl]-N-[7-hydroxy-4-(2-hydroxyethyl)heptyl]benzamide.
| Compound Name | 4-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]cyclopentyl]-N-[7-hydroxy-4-(2-hydroxyethyl)heptyl]benzamide |
|---|---|
| PubChem CID | 91531453 |
| Molecular Formula | C30H43FN2O4 |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 4-[3-[1-(4-fluoro-3-methoxyphenyl)ethylamino]cyclopentyl]-N-[7-hydroxy-4-(2-hydroxyethyl)heptyl]benzamide |
| SMILES | COc1cc(C(C)NC2CCC(c3ccc(C(=O)NCCCC(CCO)CCCO)cc3)C2)ccc1F |
| InChI | InChI=1S/C30H43FN2O4/c1-21(25-12-14-28(31)29(20-25)37-2)33-27-13-11-26(19-27)23-7-9-24(10-8-23)30(36)32-16-3-5-22(15-18-35)6-4-17-34/h7-10,12,14,20-22,26-27,33-35H,3-6,11,13,15-19H2,1-2H3,(H,32,36) |
| InChIKey | FRHSVTNFNAZJNU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|