C12H21N3S — CID 105232079
[1-cycloheptyl-2-(1,3-thiazol-2-yl)ethyl]hydrazine (PubChem CID 105232079) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is [1-cycloheptyl-2-(1,3-thiazol-2-yl)ethyl]hydrazine.
| Compound Name | [1-cycloheptyl-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105232079 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [1-cycloheptyl-2-(1,3-thiazol-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1nccs1)C1CCCCCC1 |
| InChI | InChI=1S/C12H21N3S/c13-15-11(9-12-14-7-8-16-12)10-5-3-1-2-4-6-10/h7-8,10-11,15H,1-6,9,13H2 |
| InChIKey | RQQSQZPCZWUVLE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|