C12H20N2S — CID 81384667
(1R)-1-cyclohexyl-N-(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 81384667) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is (1R)-1-cyclohexyl-N-(1,3-thiazol-2-ylmethyl)ethanamine.
| Compound Name | (1R)-1-cyclohexyl-N-(1,3-thiazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 81384667 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (1R)-1-cyclohexyl-N-(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | C[C@@H](NCc1nccs1)C1CCCCC1 |
| InChI | InChI=1S/C12H20N2S/c1-10(11-5-3-2-4-6-11)14-9-12-13-7-8-15-12/h7-8,10-11,14H,2-6,9H2,1H3/t10-/m1/s1 |
| InChIKey | JTWCNBJBQCLURI-SNVBAGLBSA-N |
| XLogP | 3.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |