C10H14N2OS — CID 116547771
1-piperidin-2-yl-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 116547771) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-piperidin-2-yl-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-piperidin-2-yl-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 116547771 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-piperidin-2-yl-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(Cc1nccs1)C1CCCCN1 |
| InChI | InChI=1S/C10H14N2OS/c13-9(7-10-12-5-6-14-10)8-3-1-2-4-11-8/h5-6,8,11H,1-4,7H2 |
| InChIKey | AGIXPMKBGBNIOR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |