C10H14N2OS — CID 116587134
1-(3-aminocyclopentyl)-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 116587134) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(3-aminocyclopentyl)-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(3-aminocyclopentyl)-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 116587134 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(3-aminocyclopentyl)-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | NC1CCC(C(=O)Cc2nccs2)C1 |
| InChI | InChI=1S/C10H14N2OS/c11-8-2-1-7(5-8)9(13)6-10-12-3-4-14-10/h3-4,7-8H,1-2,5-6,11H2 |
| InChIKey | YEZCPOQKXTWFEL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |