C11H18N2S — CID 165491533
4-methyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine (PubChem CID 165491533) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 4-methyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine.
| Compound Name | 4-methyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 165491533 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-methyl-3-(1,3-thiazol-2-ylmethyl)cyclohexan-1-amine |
| SMILES | CC1CCC(N)CC1Cc1nccs1 |
| InChI | InChI=1S/C11H18N2S/c1-8-2-3-10(12)6-9(8)7-11-13-4-5-14-11/h4-5,8-10H,2-3,6-7,12H2,1H3 |
| InChIKey | HMFSNNBLJMUDEN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |