C12H18N2OS — CID 116582673
1-(azepan-2-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone (PubChem CID 116582673) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-(azepan-2-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone.
| Compound Name | 1-(azepan-2-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
|---|---|
| PubChem CID | 116582673 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-(azepan-2-yl)-2-(2-methyl-1,3-thiazol-4-yl)ethanone |
| SMILES | Cc1nc(CC(=O)C2CCCCCN2)cs1 |
| InChI | InChI=1S/C12H18N2OS/c1-9-14-10(8-16-9)7-12(15)11-5-3-2-4-6-13-11/h8,11,13H,2-7H2,1H3 |
| InChIKey | MJHUCDYWRSQQLK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |