C7H10N2S — CID 7047975
2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole (PubChem CID 7047975) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole.
| Compound Name | 2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 7047975 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 2-[(2R)-pyrrolidin-2-yl]-1,3-thiazole |
| SMILES | c1csc([C@H]2CCCN2)n1 |
| InChI | InChI=1S/C7H10N2S/c1-2-6(8-3-1)7-9-4-5-10-7/h4-6,8H,1-3H2/t6-/m1/s1 |
| InChIKey | OHXHYELTRYIFII-ZCFIWIBFSA-N |
| XLogP | 1.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |