C6H8N2OS2 — CID 123727875
4-(1,3-thiazol-2-yl)-1,3-thiazolidine 1-oxide (PubChem CID 123727875) has the molecular formula C6H8N2OS2 and a molecular weight of 188.28 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)-1,3-thiazolidine 1-oxide.
| Compound Name | 4-(1,3-thiazol-2-yl)-1,3-thiazolidine 1-oxide |
|---|---|
| PubChem CID | 123727875 |
| Molecular Formula | C6H8N2OS2 |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)-1,3-thiazolidine 1-oxide |
| SMILES | O=S1CNC(c2nccs2)C1 |
| InChI | InChI=1S/C6H8N2OS2/c9-11-3-5(8-4-11)6-7-1-2-10-6/h1-2,5,8H,3-4H2 |
| InChIKey | MUCMWPRPYURUKE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |