C8H10F2N2S — CID 105456190
2-(5,5-difluoropiperidin-3-yl)-1,3-thiazole (PubChem CID 105456190) has the molecular formula C8H10F2N2S and a molecular weight of 204.24 g/mol. Its IUPAC name is 2-(5,5-difluoropiperidin-3-yl)-1,3-thiazole.
| Compound Name | 2-(5,5-difluoropiperidin-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 105456190 |
| Molecular Formula | C8H10F2N2S |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2-(5,5-difluoropiperidin-3-yl)-1,3-thiazole |
| SMILES | FC1(F)CNCC(c2nccs2)C1 |
| InChI | InChI=1S/C8H10F2N2S/c9-8(10)3-6(4-11-5-8)7-12-1-2-13-7/h1-2,6,11H,3-5H2 |
| InChIKey | FVOGVWPUWPGFNE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |