C10H17ClN2S — CID 158523431
[4-(1,3-thiazol-2-yl)cyclohexyl]methanamine;hydrochloride (PubChem CID 158523431) has the molecular formula C10H17ClN2S and a molecular weight of 232.78 g/mol. Its IUPAC name is [4-(1,3-thiazol-2-yl)cyclohexyl]methanamine;hydrochloride.
| Compound Name | [4-(1,3-thiazol-2-yl)cyclohexyl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 158523431 |
| Molecular Formula | C10H17ClN2S |
| Molecular Weight | 232.78 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [4-(1,3-thiazol-2-yl)cyclohexyl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CCC(c2nccs2)CC1 |
| InChI | InChI=1S/C10H16N2S.ClH/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10;/h5-6,8-9H,1-4,7,11H2;1H |
| InChIKey | YAPGTUMSLTUPND-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |