C9H14N2S — CID 170533293
2-[1-(trideuteriomethyl)piperidin-4-yl]-1,3-thiazole (PubChem CID 170533293) has the molecular formula C9H14N2S and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-[1-(trideuteriomethyl)piperidin-4-yl]-1,3-thiazole.
| Compound Name | 2-[1-(trideuteriomethyl)piperidin-4-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 170533293 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-[1-(trideuteriomethyl)piperidin-4-yl]-1,3-thiazole |
| SMILES | [2H]C([2H])([2H])N1CCC(c2nccs2)CC1 |
| InChI | InChI=1S/C9H14N2S/c1-11-5-2-8(3-6-11)9-10-4-7-12-9/h4,7-8H,2-3,5-6H2,1H3/i1D3 |
| InChIKey | CEDUEHPQIBFNRR-FIBGUPNXSA-N |
| XLogP | 1.95 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |