C19H24N2OS — CID 110308176
3-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one (PubChem CID 110308176) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is 3-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one.
| Compound Name | 3-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110308176 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]butan-1-one |
| SMILES | CC(C)(CC(=O)N1CCC(c2nccs2)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2OS/c1-19(2,16-6-4-3-5-7-16)14-17(22)21-11-8-15(9-12-21)18-20-10-13-23-18/h3-7,10,13,15H,8-9,11-12,14H2,1-2H3 |
| InChIKey | FRLDNYZSCKXZBC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |