C18H20N2OS — CID 110308213
(E)-2-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 110308213) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is (E)-2-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-2-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 110308213 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (E)-2-methyl-3-phenyl-1-[4-(1,3-thiazol-2-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C/C(=C\c1ccccc1)C(=O)N1CCC(c2nccs2)CC1 |
| InChI | InChI=1S/C18H20N2OS/c1-14(13-15-5-3-2-4-6-15)18(21)20-10-7-16(8-11-20)17-19-9-12-22-17/h2-6,9,12-13,16H,7-8,10-11H2,1H3/b14-13+ |
| InChIKey | MJKBTILNEFHZAQ-BUHFOSPRSA-N |
| XLogP | 3.95 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|