C17H21NO3 — CID 889257
methyl 1-(2-methyl-3-phenylprop-2-enoyl)piperidine-4-carboxylate (PubChem CID 889257) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 1-(2-methyl-3-phenylprop-2-enoyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(2-methyl-3-phenylprop-2-enoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 889257 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl 1-(2-methyl-3-phenylprop-2-enoyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)C(C)=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H21NO3/c1-13(12-14-6-4-3-5-7-14)16(19)18-10-8-15(9-11-18)17(20)21-2/h3-7,12,15H,8-11H2,1-2H3 |
| InChIKey | HONFRBJMTDIVIW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|