C9H13N2SW- — CID 59496771
2-(1-methanidylpiperidin-4-yl)-1,3-thiazole;tungsten (PubChem CID 59496771) has the molecular formula C9H13N2SW- and a molecular weight of 365.12 g/mol. Its IUPAC name is 2-(1-methanidylpiperidin-4-yl)-1,3-thiazole;tungsten.
| Compound Name | 2-(1-methanidylpiperidin-4-yl)-1,3-thiazole;tungsten |
|---|---|
| PubChem CID | 59496771 |
| Molecular Formula | C9H13N2SW- |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2-(1-methanidylpiperidin-4-yl)-1,3-thiazole;tungsten |
| SMILES | [CH2-]N1CCC(c2nccs2)CC1.[W] |
| InChI | InChI=1S/C9H13N2S.W/c1-11-5-2-8(3-6-11)9-10-4-7-12-9;/h4,7-8H,1-3,5-6H2;/q-1; |
| InChIKey | NQEXOMVNBGQNPV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|