C13H15NO2S — CID 150389360
8-(1,3-thiazol-2-yl)spiro[4.5]decane-1,4-dione (PubChem CID 150389360) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 8-(1,3-thiazol-2-yl)spiro[4.5]decane-1,4-dione.
| Compound Name | 8-(1,3-thiazol-2-yl)spiro[4.5]decane-1,4-dione |
|---|---|
| PubChem CID | 150389360 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 8-(1,3-thiazol-2-yl)spiro[4.5]decane-1,4-dione |
| SMILES | O=C1CCC(=O)C12CCC(c1nccs1)CC2 |
| InChI | InChI=1S/C13H15NO2S/c15-10-1-2-11(16)13(10)5-3-9(4-6-13)12-14-7-8-17-12/h7-9H,1-6H2 |
| InChIKey | HBJJGOQMPQNQES-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|