C15H13F3N2OS — CID 110289798
[4-(1,3-thiazol-2-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 110289798) has the molecular formula C15H13F3N2OS and a molecular weight of 326.34 g/mol. Its IUPAC name is [4-(1,3-thiazol-2-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(1,3-thiazol-2-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 110289798 |
| Molecular Formula | C15H13F3N2OS |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | [4-(1,3-thiazol-2-yl)piperidin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCC(c2nccs2)CC1 |
| InChI | InChI=1S/C15H13F3N2OS/c16-11-2-1-10(12(17)13(11)18)15(21)20-6-3-9(4-7-20)14-19-5-8-22-14/h1-2,5,8-9H,3-4,6-7H2 |
| InChIKey | YRWULYCTKHTHCV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|