C8H10N4OS — CID 136706810
2-ethylimino-5-(1,3-thiazol-2-yl)imidazolidin-4-one (PubChem CID 136706810) has the molecular formula C8H10N4OS and a molecular weight of 210.26 g/mol. Its IUPAC name is 2-ethylimino-5-(1,3-thiazol-2-yl)imidazolidin-4-one.
| Compound Name | 2-ethylimino-5-(1,3-thiazol-2-yl)imidazolidin-4-one |
|---|---|
| PubChem CID | 136706810 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-ethylimino-5-(1,3-thiazol-2-yl)imidazolidin-4-one |
| SMILES | CC/N=C1\NC(=O)C(c2nccs2)N1 |
| InChI | InChI=1S/C8H10N4OS/c1-2-9-8-11-5(6(13)12-8)7-10-3-4-14-7/h3-5H,2H2,1H3,(H2,9,11,12,13) |
| InChIKey | JADQIBLXVBVTSA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|