C10H17N3O3S2 — CID 146619371
(5S)-2-(2-ethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane 1,1-dioxide (PubChem CID 146619371) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is (5S)-2-(2-ethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane 1,1-dioxide.
| Compound Name | (5S)-2-(2-ethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 146619371 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (5S)-2-(2-ethoxyethyl)-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane 1,1-dioxide |
| SMILES | CCOCCN1CC[C@@H](c2nccs2)NS1(=O)=O |
| InChI | InChI=1S/C10H17N3O3S2/c1-2-16-7-6-13-5-3-9(12-18(13,14)15)10-11-4-8-17-10/h4,8-9,12H,2-3,5-7H2,1H3/t9-/m0/s1 |
| InChIKey | XJJONSLRZFCPSS-VIFPVBQESA-N |
| XLogP | 0.76 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|