C14H24N2OS — CID 122139894
2-[1-[2-(2-methylpropoxy)ethyl]piperidin-2-yl]-1,3-thiazole (PubChem CID 122139894) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-[1-[2-(2-methylpropoxy)ethyl]piperidin-2-yl]-1,3-thiazole.
| Compound Name | 2-[1-[2-(2-methylpropoxy)ethyl]piperidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 122139894 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-[1-[2-(2-methylpropoxy)ethyl]piperidin-2-yl]-1,3-thiazole |
| SMILES | CC(C)COCCN1CCCCC1c1nccs1 |
| InChI | InChI=1S/C14H24N2OS/c1-12(2)11-17-9-8-16-7-4-3-5-13(16)14-15-6-10-18-14/h6,10,12-13H,3-5,7-9,11H2,1-2H3 |
| InChIKey | SETDUBJNGBWYQU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|