About 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one
1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one (PubChem CID 120982588) has the molecular formula C15H24N4OS
and a molecular weight of 308.45 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one |
| PubChem CID | 120982588 |
| Molecular Formula | C15H24N4OS |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CCCCC1c1nccs1)N1CCNCC1 |
| InChI | InChI=1S/C15H24N4OS/c20-14(19-10-5-16-6-11-19)4-9-18-8-2-1-3-13(18)15-17-7-12-21-15/h7,12-13,16H,1-6,8-11H2 |
| InChIKey | HLSZAOPWSIKWGA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one?
The IUPAC name of 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one (CID 120982588) is 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one.
What is the SMILES notation for 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one?
The canonical SMILES for 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one is O=C(CCN1CCCCC1c1nccs1)N1CCNCC1.
What is the InChIKey of 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one?
The InChIKey is HLSZAOPWSIKWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4OS/c20-14(19-10-5-16-6-11-19)4-9-18-8-2-1-3-13(18)15-17-7-12-21-15/h7,12-13,16H,1-6,8-11H2.
What are the key properties of 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one?
1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one has a molecular weight of 308.45 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-yl-3-[2-(1,3-thiazol-2-yl)piperidin-1-yl]propan-1-one is sourced from PubChem (CID 120982588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).