C9H11N3S — CID 130666209
2-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]acetonitrile (PubChem CID 130666209) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]acetonitrile.
| Compound Name | 2-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 130666209 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]acetonitrile |
| SMILES | N#CCN1CCCC1c1nccs1 |
| InChI | InChI=1S/C9H11N3S/c10-3-6-12-5-1-2-8(12)9-11-4-7-13-9/h4,7-8H,1-2,5-6H2 |
| InChIKey | PGQAZFLYHDABGX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|