C17H20ClFN4O4S2 — CID 135317589
(3S,5R)-N-(3-chloro-4-fluorophenyl)-2-(3-methoxypropyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317589) has the molecular formula C17H20ClFN4O4S2 and a molecular weight of 462.96 g/mol. Its IUPAC name is (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-(3-methoxypropyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-(3-methoxypropyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317589 |
| Molecular Formula | C17H20ClFN4O4S2 |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-2-(3-methoxypropyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | COCCCN1[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@H](c2nccs2)NS1(=O)=O |
| InChI | InChI=1S/C17H20ClFN4O4S2/c1-27-7-2-6-23-15(16(24)21-11-3-4-13(19)12(18)9-11)10-14(22-29(23,25)26)17-20-5-8-28-17/h3-5,8-9,14-15,22H,2,6-7,10H2,1H3,(H,21,24)/t14-,15+/m1/s1 |
| InChIKey | YRBBLYHPMYXVFC-CABCVRRESA-N |
| XLogP | 2.56 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|