C14H13BrClFN4O3S2 — CID 135317056
(3S,5R)-5-(4-bromo-1,3-thiazol-2-yl)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317056) has the molecular formula C14H13BrClFN4O3S2 and a molecular weight of 483.77 g/mol. Its IUPAC name is (3S,5R)-5-(4-bromo-1,3-thiazol-2-yl)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-5-(4-bromo-1,3-thiazol-2-yl)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317056 |
| Molecular Formula | C14H13BrClFN4O3S2 |
| Molecular Weight | 483.77 g/mol |
| Exact Mass | 481.93 |
| IUPAC Name | (3S,5R)-5-(4-bromo-1,3-thiazol-2-yl)-N-(3-chloro-4-fluorophenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@H](c2nc(Br)cs2)NS1(=O)=O |
| InChI | InChI=1S/C14H13BrClFN4O3S2/c1-21-11(13(22)18-7-2-3-9(17)8(16)4-7)5-10(20-26(21,23)24)14-19-12(15)6-25-14/h2-4,6,10-11,20H,5H2,1H3,(H,18,22)/t10-,11+/m1/s1 |
| InChIKey | KDIHEYGTALQEOF-MNOVXSKESA-N |
| XLogP | 2.92 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |