C17H15Cl3FN3O4S — CID 135317228
(3S,5R)-N-(3-chloro-4-fluorophenyl)-5-(3,5-dichloro-4-hydroxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135317228) has the molecular formula C17H15Cl3FN3O4S and a molecular weight of 482.75 g/mol. Its IUPAC name is (3S,5R)-N-(3-chloro-4-fluorophenyl)-5-(3,5-dichloro-4-hydroxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-5-(3,5-dichloro-4-hydroxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135317228 |
| Molecular Formula | C17H15Cl3FN3O4S |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | (3S,5R)-N-(3-chloro-4-fluorophenyl)-5-(3,5-dichloro-4-hydroxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | CN1[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@H](c2cc(Cl)c(O)c(Cl)c2)NS1(=O)=O |
| InChI | InChI=1S/C17H15Cl3FN3O4S/c1-24-15(17(26)22-9-2-3-13(21)10(18)6-9)7-14(23-29(24,27)28)8-4-11(19)16(25)12(20)5-8/h2-6,14-15,23,25H,7H2,1H3,(H,22,26)/t14-,15+/m1/s1 |
| InChIKey | QNSGKTRDGOBAFZ-CABCVRRESA-N |
| XLogP | 3.71 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |