C17H16ClFN4O3S2 — CID 135316330
(3R,5S)-2-but-3-ynyl-N-(3-chloro-4-fluorophenyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide (PubChem CID 135316330) has the molecular formula C17H16ClFN4O3S2 and a molecular weight of 442.93 g/mol. Its IUPAC name is (3R,5S)-2-but-3-ynyl-N-(3-chloro-4-fluorophenyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide.
| Compound Name | (3R,5S)-2-but-3-ynyl-N-(3-chloro-4-fluorophenyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
|---|---|
| PubChem CID | 135316330 |
| Molecular Formula | C17H16ClFN4O3S2 |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | (3R,5S)-2-but-3-ynyl-N-(3-chloro-4-fluorophenyl)-1,1-dioxo-5-(1,3-thiazol-2-yl)-1,2,6-thiadiazinane-3-carboxamide |
| SMILES | C#CCCN1[C@@H](C(=O)Nc2ccc(F)c(Cl)c2)C[C@@H](c2nccs2)NS1(=O)=O |
| InChI | InChI=1S/C17H16ClFN4O3S2/c1-2-3-7-23-15(16(24)21-11-4-5-13(19)12(18)9-11)10-14(22-28(23,25)26)17-20-6-8-27-17/h1,4-6,8-9,14-15,22H,3,7,10H2,(H,21,24)/t14-,15+/m0/s1 |
| InChIKey | WHMIQIPPGYPFHB-LSDHHAIUSA-N |
| XLogP | 2.55 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|