C12H12FNOS — CID 112645256
2-(4-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-1-ol (PubChem CID 112645256) has the molecular formula C12H12FNOS and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-1-ol.
| Compound Name | 2-(4-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 112645256 |
| Molecular Formula | C12H12FNOS |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-(4-fluorophenyl)-3-(1,3-thiazol-5-yl)propan-1-ol |
| SMILES | OCC(Cc1cncs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNOS/c13-11-3-1-9(2-4-11)10(7-15)5-12-6-14-8-16-12/h1-4,6,8,10,15H,5,7H2 |
| InChIKey | WYDKKILZAMTMQK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |