C17H13F2NOS2 — CID 155534330
5-[bis(4-fluorophenyl)methylsulfinylmethyl]-1,3-thiazole (PubChem CID 155534330) has the molecular formula C17H13F2NOS2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 5-[bis(4-fluorophenyl)methylsulfinylmethyl]-1,3-thiazole.
| Compound Name | 5-[bis(4-fluorophenyl)methylsulfinylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 155534330 |
| Molecular Formula | C17H13F2NOS2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 5-[bis(4-fluorophenyl)methylsulfinylmethyl]-1,3-thiazole |
| SMILES | O=S(Cc1cncs1)C(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F2NOS2/c18-14-5-1-12(2-6-14)17(13-3-7-15(19)8-4-13)23(21)10-16-9-20-11-22-16/h1-9,11,17H,10H2 |
| InChIKey | WGAYLKKCGZOQDP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |