C12H13FN2S — CID 112642697
1-(4-fluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 112642697) has the molecular formula C12H13FN2S and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(4-fluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 112642697 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methyl-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | CNC(Cc1cncs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2S/c1-14-12(6-11-7-15-8-16-11)9-2-4-10(13)5-3-9/h2-5,7-8,12,14H,6H2,1H3 |
| InChIKey | QIAZUOYFYSZFSV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |