C9H8FN3S — CID 115925028
5-fluoro-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine (PubChem CID 115925028) has the molecular formula C9H8FN3S and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-fluoro-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine.
| Compound Name | 5-fluoro-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 115925028 |
| Molecular Formula | C9H8FN3S |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 5-fluoro-N-(1,3-thiazol-5-ylmethyl)pyridin-2-amine |
| SMILES | Fc1ccc(NCc2cncs2)nc1 |
| InChI | InChI=1S/C9H8FN3S/c10-7-1-2-9(12-3-7)13-5-8-4-11-6-14-8/h1-4,6H,5H2,(H,12,13) |
| InChIKey | UNNGTYQGIXRYLB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |