C6H6N4S2 — CID 130660222
N-(1,3-thiazol-5-ylmethyl)thiadiazol-4-amine (PubChem CID 130660222) has the molecular formula C6H6N4S2 and a molecular weight of 198.28 g/mol. Its IUPAC name is N-(1,3-thiazol-5-ylmethyl)thiadiazol-4-amine.
| Compound Name | N-(1,3-thiazol-5-ylmethyl)thiadiazol-4-amine |
|---|---|
| PubChem CID | 130660222 |
| Molecular Formula | C6H6N4S2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | N-(1,3-thiazol-5-ylmethyl)thiadiazol-4-amine |
| SMILES | c1ncc(CNc2csnn2)s1 |
| InChI | InChI=1S/C6H6N4S2/c1-5(11-4-7-1)2-8-6-3-12-10-9-6/h1,3-4,8H,2H2 |
| InChIKey | WULFPAXBKPBRSI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |