C13H13BrFNS — CID 112645332
5-[2-(bromomethyl)-3-(4-fluorophenyl)propyl]-1,3-thiazole (PubChem CID 112645332) has the molecular formula C13H13BrFNS and a molecular weight of 314.22 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3-(4-fluorophenyl)propyl]-1,3-thiazole.
| Compound Name | 5-[2-(bromomethyl)-3-(4-fluorophenyl)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112645332 |
| Molecular Formula | C13H13BrFNS |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 5-[2-(bromomethyl)-3-(4-fluorophenyl)propyl]-1,3-thiazole |
| SMILES | Fc1ccc(CC(CBr)Cc2cncs2)cc1 |
| InChI | InChI=1S/C13H13BrFNS/c14-7-11(6-13-8-16-9-17-13)5-10-1-3-12(15)4-2-10/h1-4,8-9,11H,5-7H2 |
| InChIKey | HUBLFCDMWQXQGE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|