C8H12BrNS — CID 112645329
5-[2-(bromomethyl)butyl]-1,3-thiazole (PubChem CID 112645329) has the molecular formula C8H12BrNS and a molecular weight of 234.16 g/mol. Its IUPAC name is 5-[2-(bromomethyl)butyl]-1,3-thiazole.
| Compound Name | 5-[2-(bromomethyl)butyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112645329 |
| Molecular Formula | C8H12BrNS |
| Molecular Weight | 234.16 g/mol |
| Exact Mass | 232.99 |
| IUPAC Name | 5-[2-(bromomethyl)butyl]-1,3-thiazole |
| SMILES | CCC(CBr)Cc1cncs1 |
| InChI | InChI=1S/C8H12BrNS/c1-2-7(4-9)3-8-5-10-6-11-8/h5-7H,2-4H2,1H3 |
| InChIKey | DJGVUUGILDIQDO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|