C11H7F5N2S — CID 105030337
1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine (PubChem CID 105030337) has the molecular formula C11H7F5N2S and a molecular weight of 294.25 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105030337 |
| Molecular Formula | C11H7F5N2S |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3-thiazol-5-yl)ethanamine |
| SMILES | NC(Cc1cncs1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H7F5N2S/c12-7-6(5(17)1-4-2-18-3-19-4)8(13)10(15)11(16)9(7)14/h2-3,5H,1,17H2 |
| InChIKey | RTKTTXBGLUOUEQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|