C13H13BrFNS — CID 62599879
2-(4-bromothiophen-2-yl)-1-(4-fluoro-3-methylphenyl)ethanamine (PubChem CID 62599879) has the molecular formula C13H13BrFNS and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(4-fluoro-3-methylphenyl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(4-fluoro-3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 62599879 |
| Molecular Formula | C13H13BrFNS |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(4-fluoro-3-methylphenyl)ethanamine |
| SMILES | Cc1cc(C(N)Cc2cc(Br)cs2)ccc1F |
| InChI | InChI=1S/C13H13BrFNS/c1-8-4-9(2-3-12(8)15)13(16)6-11-5-10(14)7-17-11/h2-5,7,13H,6,16H2,1H3 |
| InChIKey | DFYOKNCFYLNQSX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |