C11H12BrNS2 — CID 115847883
2-(4-bromothiophen-2-yl)-1-(3-methylthiophen-2-yl)ethanamine (PubChem CID 115847883) has the molecular formula C11H12BrNS2 and a molecular weight of 302.26 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-1-(3-methylthiophen-2-yl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-1-(3-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 115847883 |
| Molecular Formula | C11H12BrNS2 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-1-(3-methylthiophen-2-yl)ethanamine |
| SMILES | Cc1ccsc1C(N)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H12BrNS2/c1-7-2-3-14-11(7)10(13)5-9-4-8(12)6-15-9/h2-4,6,10H,5,13H2,1H3 |
| InChIKey | UUDUKTHTCTUSET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |