C16H23NO2SSi — CID 90071558
hydroxy-dimethyl-[2-methyl-1-[3-(1,3-thiazol-5-ylmethoxy)phenyl]propan-2-yl]silane (PubChem CID 90071558) has the molecular formula C16H23NO2SSi and a molecular weight of 321.52 g/mol. Its IUPAC name is hydroxy-dimethyl-[2-methyl-1-[3-(1,3-thiazol-5-ylmethoxy)phenyl]propan-2-yl]silane.
| Compound Name | hydroxy-dimethyl-[2-methyl-1-[3-(1,3-thiazol-5-ylmethoxy)phenyl]propan-2-yl]silane |
|---|---|
| PubChem CID | 90071558 |
| Molecular Formula | C16H23NO2SSi |
| Molecular Weight | 321.52 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | hydroxy-dimethyl-[2-methyl-1-[3-(1,3-thiazol-5-ylmethoxy)phenyl]propan-2-yl]silane |
| SMILES | CC(C)(Cc1cccc(OCc2cncs2)c1)[Si](C)(C)O |
| InChI | InChI=1S/C16H23NO2SSi/c1-16(2,21(3,4)18)9-13-6-5-7-14(8-13)19-11-15-10-17-12-20-15/h5-8,10,12,18H,9,11H2,1-4H3 |
| InChIKey | JJKDYSGUVPESMZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|