C17H24N4O — CID 170147982
(Z)-3-amino-2-hydrazinyl-3-[3-[(4-methylcyclohexyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 170147982) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is (Z)-3-amino-2-hydrazinyl-3-[3-[(4-methylcyclohexyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-amino-2-hydrazinyl-3-[3-[(4-methylcyclohexyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 170147982 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | (Z)-3-amino-2-hydrazinyl-3-[3-[(4-methylcyclohexyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | CC1CCC(COc2cccc(/C(N)=C(\C#N)NN)c2)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-12-5-7-13(8-6-12)11-22-15-4-2-3-14(9-15)17(19)16(10-18)21-20/h2-4,9,12-13,21H,5-8,11,19-20H2,1H3/b17-16- |
| InChIKey | SIRASXZRPHYCDX-MSUUIHNZSA-N |
| XLogP | 2.51 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|