C17H15F2NO2 — CID 141084193
1-[4-[(3,4-difluorophenyl)methoxy]phenyl]pyrrolidin-2-one (PubChem CID 141084193) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is 1-[4-[(3,4-difluorophenyl)methoxy]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[(3,4-difluorophenyl)methoxy]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141084193 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 1-[4-[(3,4-difluorophenyl)methoxy]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(OCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C17H15F2NO2/c18-15-8-3-12(10-16(15)19)11-22-14-6-4-13(5-7-14)20-9-1-2-17(20)21/h3-8,10H,1-2,9,11H2 |
| InChIKey | ZVFYLNYSDIXYRH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |