C18H15F2NO3S — CID 35545428
[4-(2-oxopyrrolidin-1-yl)phenyl] 2-(3,4-difluorophenyl)sulfanylacetate (PubChem CID 35545428) has the molecular formula C18H15F2NO3S and a molecular weight of 363.39 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 2-(3,4-difluorophenyl)sulfanylacetate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-(3,4-difluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 35545428 |
| Molecular Formula | C18H15F2NO3S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-(3,4-difluorophenyl)sulfanylacetate |
| SMILES | O=C(CSc1ccc(F)c(F)c1)Oc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H15F2NO3S/c19-15-8-7-14(10-16(15)20)25-11-18(23)24-13-5-3-12(4-6-13)21-9-1-2-17(21)22/h3-8,10H,1-2,9,11H2 |
| InChIKey | BUEPLFZNRPMBCO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|