C18H16F3NO2 — CID 112808160
1-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-one (PubChem CID 112808160) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 112808160 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc(OCc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)16-5-2-1-4-13(16)12-24-15-9-7-14(8-10-15)22-11-3-6-17(22)23/h1-2,4-5,7-10H,3,6,11-12H2 |
| InChIKey | PMCRVVILFRHBSP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |