C14H13Cl2NO2S — CID 62030972
1-(3,4-dichlorophenyl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone (PubChem CID 62030972) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone |
|---|---|
| PubChem CID | 62030972 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone |
| SMILES | Cc1ncsc1CCOCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-9-14(20-8-17-9)4-5-19-7-13(18)10-2-3-11(15)12(16)6-10/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | ILGIUKFKCUDYJO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|