C17H16Cl2O2 — CID 43801034
1-(3,4-dichlorophenyl)-2-(2,3,6-trimethylphenoxy)ethanone (PubChem CID 43801034) has the molecular formula C17H16Cl2O2 and a molecular weight of 323.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(2,3,6-trimethylphenoxy)ethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(2,3,6-trimethylphenoxy)ethanone |
|---|---|
| PubChem CID | 43801034 |
| Molecular Formula | C17H16Cl2O2 |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(2,3,6-trimethylphenoxy)ethanone |
| SMILES | Cc1ccc(C)c(OCC(=O)c2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C17H16Cl2O2/c1-10-4-5-11(2)17(12(10)3)21-9-16(20)13-6-7-14(18)15(19)8-13/h4-8H,9H2,1-3H3 |
| InChIKey | RFOGOBLTRUVISM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |