C15H12Cl2O4S — CID 11337309
2-(3,4-dichlorophenoxy)-1-(4-methylsulfonylphenyl)ethanone (PubChem CID 11337309) has the molecular formula C15H12Cl2O4S and a molecular weight of 359.23 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-1-(4-methylsulfonylphenyl)ethanone.
| Compound Name | 2-(3,4-dichlorophenoxy)-1-(4-methylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 11337309 |
| Molecular Formula | C15H12Cl2O4S |
| Molecular Weight | 359.23 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-1-(4-methylsulfonylphenyl)ethanone |
| SMILES | CS(=O)(=O)c1ccc(C(=O)COc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H12Cl2O4S/c1-22(19,20)12-5-2-10(3-6-12)15(18)9-21-11-4-7-13(16)14(17)8-11/h2-8H,9H2,1H3 |
| InChIKey | FFCQDQXVUPXKHA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |