C12H11Br2NO2S2 — CID 62031359
1-(2,5-dibromothiophen-3-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone (PubChem CID 62031359) has the molecular formula C12H11Br2NO2S2 and a molecular weight of 425.17 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone |
|---|---|
| PubChem CID | 62031359 |
| Molecular Formula | C12H11Br2NO2S2 |
| Molecular Weight | 425.17 g/mol |
| Exact Mass | 422.86 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]ethanone |
| SMILES | Cc1ncsc1CCOCC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H11Br2NO2S2/c1-7-10(18-6-15-7)2-3-17-5-9(16)8-4-11(13)19-12(8)14/h4,6H,2-3,5H2,1H3 |
| InChIKey | HOETYTDWAGDTFX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|